C26H42O5Si — CID 10961574
[(1R,2S,4S,9S,10R,12S,13R)-12-[tert-butyl(dimethyl)silyl]oxy-5,9,13-trimethyl-16-oxo-14-oxatetracyclo[11.2.1.01,10.04,9]hexadec-5-en-2-yl] acetate (PubChem CID 10961574) has the molecular formula C26H42O5Si and a molecular weight of 462.70 g/mol. Its IUPAC name is [(1R,2S,4S,9S,10R,12S,13R)-12-[tert-butyl(dimethyl)silyl]oxy-5,9,13-trimethyl-16-oxo-14-oxatetracyclo[11.2.1.01,10.04,9]hexadec-5-en-2-yl] acetate.
| Compound Name | [(1R,2S,4S,9S,10R,12S,13R)-12-[tert-butyl(dimethyl)silyl]oxy-5,9,13-trimethyl-16-oxo-14-oxatetracyclo[11.2.1.01,10.04,9]hexadec-5-en-2-yl] acetate |
|---|---|
| PubChem CID | 10961574 |
| Molecular Formula | C26H42O5Si |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | [(1R,2S,4S,9S,10R,12S,13R)-12-[tert-butyl(dimethyl)silyl]oxy-5,9,13-trimethyl-16-oxo-14-oxatetracyclo[11.2.1.01,10.04,9]hexadec-5-en-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H]2C(C)=CCC[C@]2(C)[C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]3(C)OC[C@@]12C3=O |
| InChI | InChI=1S/C26H42O5Si/c1-16-11-10-12-24(6)18(16)13-21(30-17(2)27)26-15-29-25(7,22(26)28)20(14-19(24)26)31-32(8,9)23(3,4)5/h11,18-21H,10,12-15H2,1-9H3/t18-,19+,20-,21-,24-,25+,26-/m0/s1 |
| InChIKey | FCNDQWBIIOOPBJ-KFCOXGNHSA-N |
| XLogP | 5.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|