C27H38N2O3S — CID 10961696
[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-[2-[(1S)-1-phenylethyl]-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]methanone (PubChem CID 10961696) has the molecular formula C27H38N2O3S and a molecular weight of 470.68 g/mol. Its IUPAC name is [(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-[2-[(1S)-1-phenylethyl]-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]methanone.
| Compound Name | [(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-[2-[(1S)-1-phenylethyl]-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]methanone |
|---|---|
| PubChem CID | 10961696 |
| Molecular Formula | C27H38N2O3S |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | [(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-[2-[(1S)-1-phenylethyl]-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]methanone |
| SMILES | C[C@@H](c1ccccc1)N1CC2CCCCC2(C(=O)N2[C@@H]3C[C@H]4CC[C@]3(CS2(=O)=O)C4(C)C)C1 |
| InChI | InChI=1S/C27H38N2O3S/c1-19(20-9-5-4-6-10-20)28-16-22-11-7-8-13-26(22,17-28)24(30)29-23-15-21-12-14-27(23,25(21,2)3)18-33(29,31)32/h4-6,9-10,19,21-23H,7-8,11-18H2,1-3H3/t19-,21+,22?,23+,26?,27+/m0/s1 |
| InChIKey | NERHDBFHAZAWIZ-XQWINDMESA-N |
| XLogP | 4.61 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |