C18H28BrNO5S2 — CID 10961880
[(Z,2R,5S)-3-bromo-6-methyl-5-[(2,4,6-trimethylphenyl)sulfonylamino]hept-3-en-2-yl] methanesulfonate (PubChem CID 10961880) has the molecular formula C18H28BrNO5S2 and a molecular weight of 482.46 g/mol. Its IUPAC name is [(Z,2R,5S)-3-bromo-6-methyl-5-[(2,4,6-trimethylphenyl)sulfonylamino]hept-3-en-2-yl] methanesulfonate.
| Compound Name | [(Z,2R,5S)-3-bromo-6-methyl-5-[(2,4,6-trimethylphenyl)sulfonylamino]hept-3-en-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 10961880 |
| Molecular Formula | C18H28BrNO5S2 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | [(Z,2R,5S)-3-bromo-6-methyl-5-[(2,4,6-trimethylphenyl)sulfonylamino]hept-3-en-2-yl] methanesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@H](/C=C(\Br)[C@@H](C)OS(C)(=O)=O)C(C)C)c(C)c1 |
| InChI | InChI=1S/C18H28BrNO5S2/c1-11(2)17(10-16(19)15(6)25-26(7,21)22)20-27(23,24)18-13(4)8-12(3)9-14(18)5/h8-11,15,17,20H,1-7H3/b16-10-/t15-,17-/m1/s1 |
| InChIKey | UJJVIHYDMLVPDY-ZTUONRJZSA-N |
| XLogP | 3.56 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|