C28H30O8 — CID 10962054
(3-hydroxy-2,5,6-trimethylphenyl) 4-(2,4-dihydroxy-3,6-dimethylbenzoyl)oxy-2-hydroxy-3,5,6-trimethylbenzoate (PubChem CID 10962054) has the molecular formula C28H30O8 and a molecular weight of 494.54 g/mol. Its IUPAC name is (3-hydroxy-2,5,6-trimethylphenyl) 4-(2,4-dihydroxy-3,6-dimethylbenzoyl)oxy-2-hydroxy-3,5,6-trimethylbenzoate.
| Compound Name | (3-hydroxy-2,5,6-trimethylphenyl) 4-(2,4-dihydroxy-3,6-dimethylbenzoyl)oxy-2-hydroxy-3,5,6-trimethylbenzoate |
|---|---|
| PubChem CID | 10962054 |
| Molecular Formula | C28H30O8 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | (3-hydroxy-2,5,6-trimethylphenyl) 4-(2,4-dihydroxy-3,6-dimethylbenzoyl)oxy-2-hydroxy-3,5,6-trimethylbenzoate |
| SMILES | Cc1cc(O)c(C)c(OC(=O)c2c(C)c(C)c(OC(=O)c3c(C)cc(O)c(C)c3O)c(C)c2O)c1C |
| InChI | InChI=1S/C28H30O8/c1-11-9-20(30)17(7)25(13(11)3)35-28(34)22-14(4)15(5)26(18(8)24(22)32)36-27(33)21-12(2)10-19(29)16(6)23(21)31/h9-10,29-32H,1-8H3 |
| InChIKey | UPKGXNUGBGHQFZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|