C29H40O5Si — CID 10962094
(3aR,4S,5R,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 10962094) has the molecular formula C29H40O5Si and a molecular weight of 496.72 g/mol. Its IUPAC name is (3aR,4S,5R,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3aR,4S,5R,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 10962094 |
| Molecular Formula | C29H40O5Si |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | (3aR,4S,5R,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1[C@H]2CC(O)O[C@H]2C[C@H]1OC1CCCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H40O5Si/c1-29(2,3)35(21-12-6-4-7-13-21,22-14-8-5-9-15-22)32-20-24-23-18-27(30)33-25(23)19-26(24)34-28-16-10-11-17-31-28/h4-9,12-15,23-28,30H,10-11,16-20H2,1-3H3/t23-,24-,25+,26-,27?,28?/m1/s1 |
| InChIKey | SKWWLDXJQACQID-DPSZBLHXSA-N |
| XLogP | 4.22 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|