C23H19ClF5NO4 — CID 10962199
diethyl 2-(3-chloro-1,2,2,3,3-pentafluoropropyl)-3-phenylindolizine-1,7-dicarboxylate (PubChem CID 10962199) has the molecular formula C23H19ClF5NO4 and a molecular weight of 503.85 g/mol. Its IUPAC name is diethyl 2-(3-chloro-1,2,2,3,3-pentafluoropropyl)-3-phenylindolizine-1,7-dicarboxylate.
| Compound Name | diethyl 2-(3-chloro-1,2,2,3,3-pentafluoropropyl)-3-phenylindolizine-1,7-dicarboxylate |
|---|---|
| PubChem CID | 10962199 |
| Molecular Formula | C23H19ClF5NO4 |
| Molecular Weight | 503.85 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | diethyl 2-(3-chloro-1,2,2,3,3-pentafluoropropyl)-3-phenylindolizine-1,7-dicarboxylate |
| SMILES | CCOC(=O)c1ccn2c(-c3ccccc3)c(C(F)C(F)(F)C(F)(F)Cl)c(C(=O)OCC)c2c1 |
| InChI | InChI=1S/C23H19ClF5NO4/c1-3-33-20(31)14-10-11-30-15(12-14)16(21(32)34-4-2)17(18(30)13-8-6-5-7-9-13)19(25)22(26,27)23(24,28)29/h5-12,19H,3-4H2,1-2H3 |
| InChIKey | OBSXFZVIDOWGPP-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.85 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|