C25H54O5Si3 — CID 10962366
(5R)-5-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(triethylsilyloxy)propyl]oxolan-2-one (PubChem CID 10962366) has the molecular formula C25H54O5Si3 and a molecular weight of 518.96 g/mol. Its IUPAC name is (5R)-5-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(triethylsilyloxy)propyl]oxolan-2-one.
| Compound Name | (5R)-5-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(triethylsilyloxy)propyl]oxolan-2-one |
|---|---|
| PubChem CID | 10962366 |
| Molecular Formula | C25H54O5Si3 |
| Molecular Weight | 518.96 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | (5R)-5-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(triethylsilyloxy)propyl]oxolan-2-one |
| SMILES | CC[Si](CC)(CC)OC[C@@H](O[Si](CC)(CC)CC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C25H54O5Si3/c1-12-32(13-2,14-3)27-20-22(29-33(15-4,16-5)17-6)24(21-18-19-23(26)28-21)30-31(10,11)25(7,8)9/h21-22,24H,12-20H2,1-11H3/t21-,22-,24+/m1/s1 |
| InChIKey | OMAKPYOWORAGMH-AKFKNWHVSA-N |
| XLogP | 7.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.96 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|