C26H47F3O4SSi — CID 10962580
[(4aR,5R,8aR)-4a-methyl-5-[(2R)-6-methyl-6-triethylsilyloxyheptan-2-yl]-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl] trifluoromethanesulfonate (PubChem CID 10962580) has the molecular formula C26H47F3O4SSi and a molecular weight of 540.81 g/mol. Its IUPAC name is [(4aR,5R,8aR)-4a-methyl-5-[(2R)-6-methyl-6-triethylsilyloxyheptan-2-yl]-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl] trifluoromethanesulfonate.
| Compound Name | [(4aR,5R,8aR)-4a-methyl-5-[(2R)-6-methyl-6-triethylsilyloxyheptan-2-yl]-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10962580 |
| Molecular Formula | C26H47F3O4SSi |
| Molecular Weight | 540.81 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | [(4aR,5R,8aR)-4a-methyl-5-[(2R)-6-methyl-6-triethylsilyloxyheptan-2-yl]-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl] trifluoromethanesulfonate |
| SMILES | CC[Si](CC)(CC)OC(C)(C)CCC[C@@H](C)[C@H]1CCC[C@H]2C(OS(=O)(=O)C(F)(F)F)=CCC[C@]12C |
| InChI | InChI=1S/C26H47F3O4SSi/c1-8-35(9-2,10-3)33-24(5,6)18-12-14-20(4)21-15-11-16-22-23(17-13-19-25(21,22)7)32-34(30,31)26(27,28)29/h17,20-22H,8-16,18-19H2,1-7H3/t20-,21-,22+,25-/m1/s1 |
| InChIKey | BRELVTRMMOKCNN-ILSIFQBBSA-N |
| XLogP | 8.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.81 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|