C27H56O6Si3 — CID 10962757
methyl (3S,4S,5R,6R)-6-methoxy-3,4,5-tris(triethylsilyloxy)cyclohexene-1-carboxylate (PubChem CID 10962757) has the molecular formula C27H56O6Si3 and a molecular weight of 561.00 g/mol. Its IUPAC name is methyl (3S,4S,5R,6R)-6-methoxy-3,4,5-tris(triethylsilyloxy)cyclohexene-1-carboxylate.
| Compound Name | methyl (3S,4S,5R,6R)-6-methoxy-3,4,5-tris(triethylsilyloxy)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 10962757 |
| Molecular Formula | C27H56O6Si3 |
| Molecular Weight | 561.00 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | methyl (3S,4S,5R,6R)-6-methoxy-3,4,5-tris(triethylsilyloxy)cyclohexene-1-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H](O[Si](CC)(CC)CC)[C@H](OC)C(C(=O)OC)=C[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C27H56O6Si3/c1-12-34(13-2,14-3)31-23-21-22(27(28)30-11)24(29-10)26(33-36(18-7,19-8)20-9)25(23)32-35(15-4,16-5)17-6/h21,23-26H,12-20H2,1-11H3/t23-,24+,25-,26+/m0/s1 |
| InChIKey | JNRQDPAHVSJJPW-ROXDYWFKSA-N |
| XLogP | 7.29 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.00 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|