C24H28N2O10S2 — CID 10962821
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4Z)-1-ethyl-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 10962821) has the molecular formula C24H28N2O10S2 and a molecular weight of 568.63 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4Z)-1-ethyl-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4Z)-1-ethyl-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10962821 |
| Molecular Formula | C24H28N2O10S2 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4Z)-1-ethyl-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CCN1C(=O)/C(=C/c2cccs2)N=C1S[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H28N2O10S2/c1-6-26-22(31)17(10-16-8-7-9-37-16)25-24(26)38-23-21(35-15(5)30)20(34-14(4)29)19(33-13(3)28)18(36-23)11-32-12(2)27/h7-10,18-21,23H,6,11H2,1-5H3/b17-10-/t18-,19-,20+,21-,23+/m1/s1 |
| InChIKey | CHIVTWAWWBOOEK-VPYPNMMPSA-N |
| XLogP | 2.12 |
| TPSA | 147.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|