C29H37ClN2O8 — CID 10962885
5-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]pentanoic acid (PubChem CID 10962885) has the molecular formula C29H37ClN2O8 and a molecular weight of 577.07 g/mol. Its IUPAC name is 5-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]pentanoic acid.
| Compound Name | 5-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 10962885 |
| Molecular Formula | C29H37ClN2O8 |
| Molecular Weight | 577.07 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | 5-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]pentanoic acid |
| SMILES | COc1cccc([C@H]2O[C@H](CC(=O)NCCCCC(=O)O)C(=O)N(CC(C)(C)CO)c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C29H37ClN2O8/c1-29(2,17-33)16-32-21-12-11-18(30)14-20(21)26(19-8-7-9-22(38-3)27(19)39-4)40-23(28(32)37)15-24(34)31-13-6-5-10-25(35)36/h7-9,11-12,14,23,26,33H,5-6,10,13,15-17H2,1-4H3,(H,31,34)(H,35,36)/t23-,26-/m1/s1 |
| InChIKey | XDMYGTWAYIOWAW-ZEQKJWHPSA-N |
| XLogP | 3.96 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.07 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|