C24H34O16 — CID 10962895
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R)-4,5-diacetyloxy-2-methoxyoxan-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 10962895) has the molecular formula C24H34O16 and a molecular weight of 578.52 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R)-4,5-diacetyloxy-2-methoxyoxan-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R)-4,5-diacetyloxy-2-methoxyoxan-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10962895 |
| Molecular Formula | C24H34O16 |
| Molecular Weight | 578.52 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R)-4,5-diacetyloxy-2-methoxyoxan-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1O[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H34O16/c1-10(25)32-8-17-18(35-12(3)27)20(37-14(5)29)22(38-15(6)30)24(39-17)40-21-19(36-13(4)28)16(34-11(2)26)9-33-23(21)31-7/h16-24H,8-9H2,1-7H3/t16-,17-,18-,19+,20+,21-,22-,23-,24+/m1/s1 |
| InChIKey | DWNYBWBMGQILJO-PLVANIRESA-N |
| XLogP | -0.68 |
| TPSA | 194.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.52 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|