About butyl(triphenyl)boranuide;diphenyliodanium
butyl(triphenyl)boranuide;diphenyliodanium (PubChem CID 10962913) has the molecular formula C34H34BI
and a molecular weight of 580.36 g/mol. Its IUPAC name is butyl(triphenyl)boranuide;diphenyliodanium.
Molecular Properties
| Compound Name | butyl(triphenyl)boranuide;diphenyliodanium |
| PubChem CID | 10962913 |
| Molecular Formula | C34H34BI |
| Molecular Weight | 580.36 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | butyl(triphenyl)boranuide;diphenyliodanium |
| SMILES | CCCC[B-](c1ccccc1)(c1ccccc1)c1ccccc1.c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C22H24B.C12H10I/c1-2-3-19-23(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h4-18H,2-3,19H2,1H3;1-10H/q-1;+1 |
| InChIKey | FNRMRBNXJHBVLS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 580.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze butyl(triphenyl)boranuide;diphenyliodanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(triphenyl)boranuide;diphenyliodanium?
The IUPAC name of butyl(triphenyl)boranuide;diphenyliodanium (CID 10962913) is butyl(triphenyl)boranuide;diphenyliodanium.
What is the SMILES notation for butyl(triphenyl)boranuide;diphenyliodanium?
The canonical SMILES for butyl(triphenyl)boranuide;diphenyliodanium is CCCC[B-](c1ccccc1)(c1ccccc1)c1ccccc1.c1ccc([I+]c2ccccc2)cc1.
What is the InChIKey of butyl(triphenyl)boranuide;diphenyliodanium?
The InChIKey is FNRMRBNXJHBVLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24B.C12H10I/c1-2-3-19-23(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h4-18H,2-3,19H2,1H3;1-10H/q-1;+1.
What are the key properties of butyl(triphenyl)boranuide;diphenyliodanium?
butyl(triphenyl)boranuide;diphenyliodanium has a molecular weight of 580.36 g/mol, XLogP of 3.77, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(triphenyl)boranuide;diphenyliodanium is sourced from PubChem (CID 10962913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).