C18H19N3O4S2 — CID 1096301
1,1-dioxo-N-(4-piperidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-amine (PubChem CID 1096301) has the molecular formula C18H19N3O4S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 1,1-dioxo-N-(4-piperidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-amine.
| Compound Name | 1,1-dioxo-N-(4-piperidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 1096301 |
| Molecular Formula | C18H19N3O4S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 1,1-dioxo-N-(4-piperidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-amine |
| SMILES | O=S1(=O)N=C(Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)c2ccccc21 |
| InChI | InChI=1S/C18H19N3O4S2/c22-26(23)17-7-3-2-6-16(17)18(20-26)19-14-8-10-15(11-9-14)27(24,25)21-12-4-1-5-13-21/h2-3,6-11H,1,4-5,12-13H2,(H,19,20) |
| InChIKey | ROSAICUUBFNABG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |