C33H56O7Si2 — CID 10963167
(1S,5S,6R,7R,9R,12R,13R,17R,20S)-12,15,15,19,22,22-hexamethyl-20-triethylsilyloxy-7-trimethylsilyloxy-2,4,14,16-tetraoxahexacyclo[16.3.1.01,5.06,12.07,9.013,17]docos-18-en-3-one (PubChem CID 10963167) has the molecular formula C33H56O7Si2 and a molecular weight of 620.98 g/mol. Its IUPAC name is (1S,5S,6R,7R,9R,12R,13R,17R,20S)-12,15,15,19,22,22-hexamethyl-20-triethylsilyloxy-7-trimethylsilyloxy-2,4,14,16-tetraoxahexacyclo[16.3.1.01,5.06,12.07,9.013,17]docos-18-en-3-one.
| Compound Name | (1S,5S,6R,7R,9R,12R,13R,17R,20S)-12,15,15,19,22,22-hexamethyl-20-triethylsilyloxy-7-trimethylsilyloxy-2,4,14,16-tetraoxahexacyclo[16.3.1.01,5.06,12.07,9.013,17]docos-18-en-3-one |
|---|---|
| PubChem CID | 10963167 |
| Molecular Formula | C33H56O7Si2 |
| Molecular Weight | 620.98 g/mol |
| Exact Mass | 620.36 |
| IUPAC Name | (1S,5S,6R,7R,9R,12R,13R,17R,20S)-12,15,15,19,22,22-hexamethyl-20-triethylsilyloxy-7-trimethylsilyloxy-2,4,14,16-tetraoxahexacyclo[16.3.1.01,5.06,12.07,9.013,17]docos-18-en-3-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@]23OC(=O)O[C@H]2[C@H]2[C@@](C)(CC[C@@H]4C[C@@]42O[Si](C)(C)C)[C@H]2OC(C)(C)O[C@@H]2C(=C1C)C3(C)C |
| InChI | InChI=1S/C33H56O7Si2/c1-13-42(14-2,15-3)39-22-19-33-27(35-28(34)38-33)25-31(9,17-16-21-18-32(21,25)40-41(10,11)12)26-24(36-30(7,8)37-26)23(20(22)4)29(33,5)6/h21-22,24-27H,13-19H2,1-12H3/t21-,22+,24-,25+,26+,27+,31-,32-,33-/m1/s1 |
| InChIKey | CTAQRMAJBXKHKQ-HKHSZPFMSA-N |
| XLogP | 7.96 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.98 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|