C8H13N3O2 — CID 1096341
(3S)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)butanoic acid (PubChem CID 1096341) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is (3S)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)butanoic acid.
| Compound Name | (3S)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)butanoic acid |
|---|---|
| PubChem CID | 1096341 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | (3S)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)butanoic acid |
| SMILES | Cc1nc(C)n([C@@H](C)CC(=O)O)n1 |
| InChI | InChI=1S/C8H13N3O2/c1-5(4-8(12)13)11-7(3)9-6(2)10-11/h5H,4H2,1-3H3,(H,12,13)/t5-/m0/s1 |
| InChIKey | MCTPUSHEGYKPKV-YFKPBYRVSA-N |
| XLogP | 0.93 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |