About CID 10963632
CID 10963632 (PubChem CID 10963632) has the molecular formula C37H36N2O4P
and a molecular weight of 603.68 g/mol.
Molecular Properties
| Compound Name | CID 10963632 |
| PubChem CID | 10963632 |
| Molecular Formula | C37H36N2O4P |
| Molecular Weight | 603.68 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | — |
| SMILES | COC(=O)C1=C2Nc3ccccc3[C@@]23CCN([C@H](C)[C]2[CH][CH][CH][C]2P(c2ccccc2)c2ccccc2)[C@H]3[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C37H36N2O4P/c1-24(28-17-12-20-33(28)44(26-13-6-4-7-14-26)27-15-8-5-9-16-27)39-22-21-37-30-18-10-11-19-31(30)38-34(37)29(36(41)42-3)23-32(35(37)39)43-25(2)40/h4-20,24,32,35,38H,21-23H2,1-3H3/t24-,32-,35+,37+/m1/s1 |
| InChIKey | BVCCOKYJPDKTDA-YWPFALSSSA-N |
| XLogP | 5.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 603.68 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 10963632 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10963632?
The IUPAC name of CID 10963632 (CID 10963632) is not available.
What is the SMILES notation for CID 10963632?
The canonical SMILES for CID 10963632 is COC(=O)C1=C2Nc3ccccc3[C@@]23CCN([C@H](C)[C]2[CH][CH][CH][C]2P(c2ccccc2)c2ccccc2)[C@H]3[C@H](OC(C)=O)C1.
What is the InChIKey of CID 10963632?
The InChIKey is BVCCOKYJPDKTDA-YWPFALSSSA-N. The full InChI is InChI=1S/C37H36N2O4P/c1-24(28-17-12-20-33(28)44(26-13-6-4-7-14-26)27-15-8-5-9-16-27)39-22-21-37-30-18-10-11-19-31(30)38-34(37)29(36(41)42-3)23-32(35(37)39)43-25(2)40/h4-20,24,32,35,38H,21-23H2,1-3H3/t24-,32-,35+,37+/m1/s1.
What are the key properties of CID 10963632?
CID 10963632 has a molecular weight of 603.68 g/mol, XLogP of 5.44, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10963632 is sourced from PubChem (CID 10963632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).