C26H44O4Si — CID 10963681
(3S,3aS,4'R,5'R,6aS)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-ynyl]-4',5'-dimethylspiro[1,3,3a,4,5,6a-hexahydropentalene-6,2'-1,3-dioxolane]-2-one (PubChem CID 10963681) has the molecular formula C26H44O4Si and a molecular weight of 448.72 g/mol. Its IUPAC name is (3S,3aS,4'R,5'R,6aS)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-ynyl]-4',5'-dimethylspiro[1,3,3a,4,5,6a-hexahydropentalene-6,2'-1,3-dioxolane]-2-one.
| Compound Name | (3S,3aS,4'R,5'R,6aS)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-ynyl]-4',5'-dimethylspiro[1,3,3a,4,5,6a-hexahydropentalene-6,2'-1,3-dioxolane]-2-one |
|---|---|
| PubChem CID | 10963681 |
| Molecular Formula | C26H44O4Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (3S,3aS,4'R,5'R,6aS)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-ynyl]-4',5'-dimethylspiro[1,3,3a,4,5,6a-hexahydropentalene-6,2'-1,3-dioxolane]-2-one |
| SMILES | CCCCC[C@@H](C#C[C@H]1C(=O)C[C@H]2[C@@H]1CCC21O[C@H](C)[C@@H](C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H44O4Si/c1-9-10-11-12-20(30-31(7,8)25(4,5)6)13-14-22-21-15-16-26(23(21)17-24(22)27)28-18(2)19(3)29-26/h18-23H,9-12,15-17H2,1-8H3/t18-,19-,20+,21-,22-,23+/m1/s1 |
| InChIKey | PNLIQOKMWHKOAA-ZGRTYHRDSA-N |
| XLogP | 6.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|