About CID 10963695
CID 10963695 (PubChem CID 10963695) has the molecular formula C46H37FeP3+2
and a molecular weight of 738.57 g/mol.
Molecular Properties
| Compound Name | CID 10963695 |
| PubChem CID | 10963695 |
| Molecular Formula | C46H37FeP3+2 |
| Molecular Weight | 738.57 g/mol |
| Exact Mass | 738.14 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][C](P(c2ccccc2)c2ccccc2)[CH]1.[CH]1[CH][C](P(c2ccccc2)c2ccccc2)[CH][C]1P(c1ccccc1)c1ccccc1.[Fe+2] |
| InChI | InChI=1S/C29H23P2.C17H14P.Fe/c1-5-13-24(14-6-1)30(25-15-7-2-8-16-25)28-21-22-29(23-28)31(26-17-9-3-10-18-26)27-19-11-4-12-20-27;1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16;/h1-23H;1-14H;/q;;+2 |
| InChIKey | RIHRKPSYAAEKGX-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 738.57 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 10963695 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10963695?
The IUPAC name of CID 10963695 (CID 10963695) is not available.
What is the SMILES notation for CID 10963695?
The canonical SMILES for CID 10963695 is [CH]1[CH][CH][C](P(c2ccccc2)c2ccccc2)[CH]1.[CH]1[CH][C](P(c2ccccc2)c2ccccc2)[CH][C]1P(c1ccccc1)c1ccccc1.[Fe+2].
What is the InChIKey of CID 10963695?
The InChIKey is RIHRKPSYAAEKGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H23P2.C17H14P.Fe/c1-5-13-24(14-6-1)30(25-15-7-2-8-16-25)28-21-22-29(23-28)31(26-17-9-3-10-18-26)27-19-11-4-12-20-27;1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16;/h1-23H;1-14H;/q;;+2.
What are the key properties of CID 10963695?
CID 10963695 has a molecular weight of 738.57 g/mol, XLogP of 9.42, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10963695 is sourced from PubChem (CID 10963695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).