C33H43Br2F3N4O4 — CID 10963806
3-(1,3-dioxoisoindol-2-yl)propyl-[6-[3-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]propyl-dimethylazaniumyl]hexyl]-dimethylazanium dibromide (PubChem CID 10963806) has the molecular formula C33H43Br2F3N4O4 and a molecular weight of 776.53 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl-[6-[3-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]propyl-dimethylazaniumyl]hexyl]-dimethylazanium dibromide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl-[6-[3-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]propyl-dimethylazaniumyl]hexyl]-dimethylazanium dibromide |
|---|---|
| PubChem CID | 10963806 |
| Molecular Formula | C33H43Br2F3N4O4 |
| Molecular Weight | 776.53 g/mol |
| Exact Mass | 774.16 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl-[6-[3-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]propyl-dimethylazaniumyl]hexyl]-dimethylazanium dibromide |
| SMILES | C[N+](C)(CCCCCC[N+](C)(C)CCCN1C(=O)c2ccc(C(F)(F)F)cc2C1=O)CCCN1C(=O)c2ccccc2C1=O.[Br-].[Br-] |
| InChI | InChI=1S/C33H43F3N4O4.2BrH/c1-39(2,21-11-17-37-29(41)25-13-7-8-14-26(25)30(37)42)19-9-5-6-10-20-40(3,4)22-12-18-38-31(43)27-16-15-24(33(34,35)36)23-28(27)32(38)44;;/h7-8,13-16,23H,5-6,9-12,17-22H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | QDLVZNSAESXCKX-UHFFFAOYSA-L |
| XLogP | -0.90 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.53 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|