C28H29F17N2O4 — CID 10963817
(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2-methyldodecan-2-yl) 4-[(4-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate (PubChem CID 10963817) has the molecular formula C28H29F17N2O4 and a molecular weight of 780.52 g/mol. Its IUPAC name is (5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2-methyldodecan-2-yl) 4-[(4-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | (5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2-methyldodecan-2-yl) 4-[(4-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10963817 |
| Molecular Formula | C28H29F17N2O4 |
| Molecular Weight | 780.52 g/mol |
| Exact Mass | 780.19 |
| IUPAC Name | (5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2-methyldodecan-2-yl) 4-[(4-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate |
| SMILES | COc1ccc(CNC(=O)C2CCN(C(=O)OC(C)(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C28H29F17N2O4/c1-20(2,51-19(49)47-12-8-16(9-13-47)18(48)46-14-15-4-6-17(50-3)7-5-15)10-11-21(29,30)22(31,32)23(33,34)24(35,36)25(37,38)26(39,40)27(41,42)28(43,44)45/h4-7,16H,8-14H2,1-3H3,(H,46,48) |
| InChIKey | ZMDXIDCWKCKAOV-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.52 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|