C49H53NO8 — CID 10963828
(4R)-4-benzyl-3-[(3S)-3-methyl-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoyl]-1,3-oxazolidin-2-one (PubChem CID 10963828) has the molecular formula C49H53NO8 and a molecular weight of 783.96 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(3S)-3-methyl-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(3S)-3-methyl-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10963828 |
| Molecular Formula | C49H53NO8 |
| Molecular Weight | 783.96 g/mol |
| Exact Mass | 783.38 |
| IUPAC Name | (4R)-4-benzyl-3-[(3S)-3-methyl-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](CC(=O)N1C(=O)OC[C@H]1Cc1ccccc1)C[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C49H53NO8/c1-36(28-45(51)50-42(34-57-49(50)52)29-37-17-7-2-8-18-37)27-43-46(54-31-39-21-11-4-12-22-39)48(56-33-41-25-15-6-16-26-41)47(55-32-40-23-13-5-14-24-40)44(58-43)35-53-30-38-19-9-3-10-20-38/h2-26,36,42-44,46-48H,27-35H2,1H3/t36-,42+,43-,44+,46-,47-,48+/m0/s1 |
| InChIKey | GGMWDDJHNRIIOE-LKKHOOPCSA-N |
| XLogP | 8.73 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.96 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |