About 1,3-dimethylpyrrole
1,3-dimethylpyrrole (PubChem CID 10964417) has the molecular formula C6H9N
and a molecular weight of 95.14 g/mol. Its IUPAC name is 1,3-dimethylpyrrole.
Molecular Properties
| Compound Name | 1,3-dimethylpyrrole |
| PubChem CID | 10964417 |
| Molecular Formula | C6H9N |
| Molecular Weight | 95.14 g/mol |
| Exact Mass | 95.07 |
| IUPAC Name | 1,3-dimethylpyrrole |
| SMILES | Cc1ccn(C)c1 |
| InChI | InChI=1S/C6H9N/c1-6-3-4-7(2)5-6/h3-5H,1-2H3 |
| InChIKey | CTWQGTOWGFCWNW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.14 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrrole?
The IUPAC name of 1,3-dimethylpyrrole (CID 10964417) is 1,3-dimethylpyrrole.
What is the SMILES notation for 1,3-dimethylpyrrole?
The canonical SMILES for 1,3-dimethylpyrrole is Cc1ccn(C)c1.
What is the InChIKey of 1,3-dimethylpyrrole?
The InChIKey is CTWQGTOWGFCWNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N/c1-6-3-4-7(2)5-6/h3-5H,1-2H3.
What are the key properties of 1,3-dimethylpyrrole?
1,3-dimethylpyrrole has a molecular weight of 95.14 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrrole is sourced from PubChem (CID 10964417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).