About (2S,3R)-2,3-dihydroxybutanoic acid
(2S,3R)-2,3-dihydroxybutanoic acid (PubChem CID 10964471) has the molecular formula C4H8O4
and a molecular weight of 120.10 g/mol. Its IUPAC name is (2S,3R)-2,3-dihydroxybutanoic acid.
Molecular Properties
| Compound Name | (2S,3R)-2,3-dihydroxybutanoic acid |
| PubChem CID | 10964471 |
| Molecular Formula | C4H8O4 |
| Molecular Weight | 120.10 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | (2S,3R)-2,3-dihydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C4H8O4/c1-2(5)3(6)4(7)8/h2-3,5-6H,1H3,(H,7,8)/t2-,3+/m1/s1 |
| InChIKey | LOUGYXZSURQALL-GBXIJSLDSA-N |
| XLogP | -1.19 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.10 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3R)-2,3-dihydroxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-2,3-dihydroxybutanoic acid?
The IUPAC name of (2S,3R)-2,3-dihydroxybutanoic acid (CID 10964471) is (2S,3R)-2,3-dihydroxybutanoic acid.
What is the SMILES notation for (2S,3R)-2,3-dihydroxybutanoic acid?
The canonical SMILES for (2S,3R)-2,3-dihydroxybutanoic acid is C[C@@H](O)[C@H](O)C(=O)O.
What is the InChIKey of (2S,3R)-2,3-dihydroxybutanoic acid?
The InChIKey is LOUGYXZSURQALL-GBXIJSLDSA-N. The full InChI is InChI=1S/C4H8O4/c1-2(5)3(6)4(7)8/h2-3,5-6H,1H3,(H,7,8)/t2-,3+/m1/s1.
What are the key properties of (2S,3R)-2,3-dihydroxybutanoic acid?
(2S,3R)-2,3-dihydroxybutanoic acid has a molecular weight of 120.10 g/mol, XLogP of -1.19, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2,3-dihydroxybutanoic acid is sourced from PubChem (CID 10964471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).