About ethyl 1,3-oxazole-5-carboxylate
ethyl 1,3-oxazole-5-carboxylate (PubChem CID 10964603) has the molecular formula C6H7NO3
and a molecular weight of 141.13 g/mol. Its IUPAC name is ethyl 1,3-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 1,3-oxazole-5-carboxylate |
| PubChem CID | 10964603 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | ethyl 1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnco1 |
| InChI | InChI=1S/C6H7NO3/c1-2-9-6(8)5-3-7-4-10-5/h3-4H,2H2,1H3 |
| InChIKey | KRMORCCAHXFIHF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1,3-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1,3-oxazole-5-carboxylate?
The IUPAC name of ethyl 1,3-oxazole-5-carboxylate (CID 10964603) is ethyl 1,3-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 1,3-oxazole-5-carboxylate?
The canonical SMILES for ethyl 1,3-oxazole-5-carboxylate is CCOC(=O)c1cnco1.
What is the InChIKey of ethyl 1,3-oxazole-5-carboxylate?
The InChIKey is KRMORCCAHXFIHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3/c1-2-9-6(8)5-3-7-4-10-5/h3-4H,2H2,1H3.
What are the key properties of ethyl 1,3-oxazole-5-carboxylate?
ethyl 1,3-oxazole-5-carboxylate has a molecular weight of 141.13 g/mol, XLogP of 0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,3-oxazole-5-carboxylate is sourced from PubChem (CID 10964603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).