C8H14O2 — CID 10964616
1-(cyclohexen-1-yl)ethane-1,2-diol (PubChem CID 10964616) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)ethane-1,2-diol.
| Compound Name | 1-(cyclohexen-1-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 10964616 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 1-(cyclohexen-1-yl)ethane-1,2-diol |
| SMILES | OCC(O)C1=CCCCC1 |
| InChI | InChI=1S/C8H14O2/c9-6-8(10)7-4-2-1-3-5-7/h4,8-10H,1-3,5-6H2 |
| InChIKey | LRJPEIMKYXSEHG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|