C5H9NO4 — CID 10964661
(4S,5R)-4,5-bis(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 10964661) has the molecular formula C5H9NO4 and a molecular weight of 147.13 g/mol. Its IUPAC name is (4S,5R)-4,5-bis(hydroxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-4,5-bis(hydroxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10964661 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | (4S,5R)-4,5-bis(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@@H](CO)[C@H](CO)O1 |
| InChI | InChI=1S/C5H9NO4/c7-1-3-4(2-8)10-5(9)6-3/h3-4,7-8H,1-2H2,(H,6,9)/t3-,4-/m0/s1 |
| InChIKey | LEVRNHSBJGGBDZ-IMJSIDKUSA-N |
| XLogP | -1.55 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |