C10H12O2 — CID 10964852
2,3,4,5,7,8-hexahydronaphthalene-1,6-dione (PubChem CID 10964852) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 2,3,4,5,7,8-hexahydronaphthalene-1,6-dione.
| Compound Name | 2,3,4,5,7,8-hexahydronaphthalene-1,6-dione |
|---|---|
| PubChem CID | 10964852 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2,3,4,5,7,8-hexahydronaphthalene-1,6-dione |
| SMILES | O=C1CCC2=C(CCCC2=O)C1 |
| InChI | InChI=1S/C10H12O2/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h1-6H2 |
| InChIKey | KLWNDGKLGLTRLF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |