About 3-thiophen-3-yl-1,2-dihydropyrrol-5-one
3-thiophen-3-yl-1,2-dihydropyrrol-5-one (PubChem CID 10964867) has the molecular formula C8H7NOS
and a molecular weight of 165.22 g/mol. Its IUPAC name is 3-thiophen-3-yl-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 3-thiophen-3-yl-1,2-dihydropyrrol-5-one |
| PubChem CID | 10964867 |
| Molecular Formula | C8H7NOS |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 3-thiophen-3-yl-1,2-dihydropyrrol-5-one |
| SMILES | O=C1C=C(c2ccsc2)CN1 |
| InChI | InChI=1S/C8H7NOS/c10-8-3-7(4-9-8)6-1-2-11-5-6/h1-3,5H,4H2,(H,9,10) |
| InChIKey | HNJWLWXMNXPVJB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-thiophen-3-yl-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-3-yl-1,2-dihydropyrrol-5-one?
The IUPAC name of 3-thiophen-3-yl-1,2-dihydropyrrol-5-one (CID 10964867) is 3-thiophen-3-yl-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 3-thiophen-3-yl-1,2-dihydropyrrol-5-one?
The canonical SMILES for 3-thiophen-3-yl-1,2-dihydropyrrol-5-one is O=C1C=C(c2ccsc2)CN1.
What is the InChIKey of 3-thiophen-3-yl-1,2-dihydropyrrol-5-one?
The InChIKey is HNJWLWXMNXPVJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NOS/c10-8-3-7(4-9-8)6-1-2-11-5-6/h1-3,5H,4H2,(H,9,10).
What are the key properties of 3-thiophen-3-yl-1,2-dihydropyrrol-5-one?
3-thiophen-3-yl-1,2-dihydropyrrol-5-one has a molecular weight of 165.22 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-3-yl-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 10964867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).