C10H15NO — CID 10964868
(1E)-1-ethylidene-6,7,8,8a-tetrahydro-5H-indolizin-3-one (PubChem CID 10964868) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (1E)-1-ethylidene-6,7,8,8a-tetrahydro-5H-indolizin-3-one.
| Compound Name | (1E)-1-ethylidene-6,7,8,8a-tetrahydro-5H-indolizin-3-one |
|---|---|
| PubChem CID | 10964868 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (1E)-1-ethylidene-6,7,8,8a-tetrahydro-5H-indolizin-3-one |
| SMILES | C/C=C1\CC(=O)N2CCCCC12 |
| InChI | InChI=1S/C10H15NO/c1-2-8-7-10(12)11-6-4-3-5-9(8)11/h2,9H,3-7H2,1H3/b8-2+ |
| InChIKey | ZMCOODWGKWSMCV-KRXBUXKQSA-N |
| XLogP | 1.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|