About trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane
trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane (PubChem CID 10964963) has the molecular formula C9H18OSi
and a molecular weight of 170.33 g/mol. Its IUPAC name is trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane.
Molecular Properties
| Compound Name | trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane |
| PubChem CID | 10964963 |
| Molecular Formula | C9H18OSi |
| Molecular Weight | 170.33 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane |
| SMILES | C/C=C/C(C)=C/O[Si](C)(C)C |
| InChI | InChI=1S/C9H18OSi/c1-6-7-9(2)8-10-11(3,4)5/h6-8H,1-5H3/b7-6+,9-8+ |
| InChIKey | KCWJPELNBSKTNR-BLHCBFLLSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane?
The IUPAC name of trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane (CID 10964963) is trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane.
What is the SMILES notation for trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane?
The canonical SMILES for trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane is C/C=C/C(C)=C/O[Si](C)(C)C.
What is the InChIKey of trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane?
The InChIKey is KCWJPELNBSKTNR-BLHCBFLLSA-N. The full InChI is InChI=1S/C9H18OSi/c1-6-7-9(2)8-10-11(3,4)5/h6-8H,1-5H3/b7-6+,9-8+.
What are the key properties of trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane?
trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane has a molecular weight of 170.33 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane is sourced from PubChem (CID 10964963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).