C11H22O2 — CID 10965239
(4S,6S,7S)-7-hydroxy-4,6-dimethylnonan-3-one (PubChem CID 10965239) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (4S,6S,7S)-7-hydroxy-4,6-dimethylnonan-3-one.
| Compound Name | (4S,6S,7S)-7-hydroxy-4,6-dimethylnonan-3-one |
|---|---|
| PubChem CID | 10965239 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (4S,6S,7S)-7-hydroxy-4,6-dimethylnonan-3-one |
| SMILES | CCC(=O)[C@@H](C)C[C@H](C)[C@@H](O)CC |
| InChI | InChI=1S/C11H22O2/c1-5-10(12)8(3)7-9(4)11(13)6-2/h8-10,12H,5-7H2,1-4H3/t8-,9-,10-/m0/s1 |
| InChIKey | YEKDTNYNLCQHPV-GUBZILKMSA-N |
| XLogP | 2.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |