About 5,8-dihydroxy-2,3-dihydronaphthalene-1,4-dione
5,8-dihydroxy-2,3-dihydronaphthalene-1,4-dione (PubChem CID 10965344) has the molecular formula C10H8O4
and a molecular weight of 192.17 g/mol. Its IUPAC name is 5,8-dihydroxy-2,3-dihydronaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 5,8-dihydroxy-2,3-dihydronaphthalene-1,4-dione |
| PubChem CID | 10965344 |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 5,8-dihydroxy-2,3-dihydronaphthalene-1,4-dione |
| SMILES | O=C1CCC(=O)c2c(O)ccc(O)c21 |
| InChI | InChI=1S/C10H8O4/c11-5-1-2-6(12)10-8(14)4-3-7(13)9(5)10/h1-2,11-12H,3-4H2 |
| InChIKey | HQFIIOPDBQMRIE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 5,8-dihydroxy-2,3-dihydronaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dihydroxy-2,3-dihydronaphthalene-1,4-dione?
The IUPAC name of 5,8-dihydroxy-2,3-dihydronaphthalene-1,4-dione (CID 10965344) is 5,8-dihydroxy-2,3-dihydronaphthalene-1,4-dione.
What is the SMILES notation for 5,8-dihydroxy-2,3-dihydronaphthalene-1,4-dione?
The canonical SMILES for 5,8-dihydroxy-2,3-dihydronaphthalene-1,4-dione is O=C1CCC(=O)c2c(O)ccc(O)c21.
What is the InChIKey of 5,8-dihydroxy-2,3-dihydronaphthalene-1,4-dione?
The InChIKey is HQFIIOPDBQMRIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O4/c11-5-1-2-6(12)10-8(14)4-3-7(13)9(5)10/h1-2,11-12H,3-4H2.
What are the key properties of 5,8-dihydroxy-2,3-dihydronaphthalene-1,4-dione?
5,8-dihydroxy-2,3-dihydronaphthalene-1,4-dione has a molecular weight of 192.17 g/mol, XLogP of 1.26, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dihydroxy-2,3-dihydronaphthalene-1,4-dione is sourced from PubChem (CID 10965344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).