About propan-2-yl 2-phenylpropanoate
propan-2-yl 2-phenylpropanoate (PubChem CID 10965354) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is propan-2-yl 2-phenylpropanoate.
Molecular Properties
| Compound Name | propan-2-yl 2-phenylpropanoate |
| PubChem CID | 10965354 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | propan-2-yl 2-phenylpropanoate |
| SMILES | CC(C)OC(=O)C(C)c1ccccc1 |
| InChI | InChI=1S/C12H16O2/c1-9(2)14-12(13)10(3)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| InChIKey | PLBPZACPOTWOJD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-yl 2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-phenylpropanoate?
The IUPAC name of propan-2-yl 2-phenylpropanoate (CID 10965354) is propan-2-yl 2-phenylpropanoate.
What is the SMILES notation for propan-2-yl 2-phenylpropanoate?
The canonical SMILES for propan-2-yl 2-phenylpropanoate is CC(C)OC(=O)C(C)c1ccccc1.
What is the InChIKey of propan-2-yl 2-phenylpropanoate?
The InChIKey is PLBPZACPOTWOJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-9(2)14-12(13)10(3)11-7-5-4-6-8-11/h4-10H,1-3H3.
What are the key properties of propan-2-yl 2-phenylpropanoate?
propan-2-yl 2-phenylpropanoate has a molecular weight of 192.26 g/mol, XLogP of 2.74, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-phenylpropanoate is sourced from PubChem (CID 10965354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).