C10H24O2Si — CID 10965634
(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxybutan-2-ol (PubChem CID 10965634) has the molecular formula C10H24O2Si and a molecular weight of 204.39 g/mol. Its IUPAC name is (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxybutan-2-ol.
| Compound Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxybutan-2-ol |
|---|---|
| PubChem CID | 10965634 |
| Molecular Formula | C10H24O2Si |
| Molecular Weight | 204.39 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxybutan-2-ol |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O |
| InChI | InChI=1S/C10H24O2Si/c1-8(11)9(2)12-13(6,7)10(3,4)5/h8-9,11H,1-7H3/t8-,9+/m1/s1 |
| InChIKey | KMSOZLNJDBYOHD-BDAKNGLRSA-N |
| XLogP | 2.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|