About 3,3-bis(ethylsulfanyl)-N,N-dimethylprop-2-en-1-amine
3,3-bis(ethylsulfanyl)-N,N-dimethylprop-2-en-1-amine (PubChem CID 10965650) has the molecular formula C9H19NS2
and a molecular weight of 205.39 g/mol. Its IUPAC name is 3,3-bis(ethylsulfanyl)-N,N-dimethylprop-2-en-1-amine.
Molecular Properties
| Compound Name | 3,3-bis(ethylsulfanyl)-N,N-dimethylprop-2-en-1-amine |
| PubChem CID | 10965650 |
| Molecular Formula | C9H19NS2 |
| Molecular Weight | 205.39 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 3,3-bis(ethylsulfanyl)-N,N-dimethylprop-2-en-1-amine |
| SMILES | CCSC(=CCN(C)C)SCC |
| InChI | InChI=1S/C9H19NS2/c1-5-11-9(12-6-2)7-8-10(3)4/h7H,5-6,8H2,1-4H3 |
| InChIKey | WWYAARCXIJEJPG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-bis(ethylsulfanyl)-N,N-dimethylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(ethylsulfanyl)-N,N-dimethylprop-2-en-1-amine?
The IUPAC name of 3,3-bis(ethylsulfanyl)-N,N-dimethylprop-2-en-1-amine (CID 10965650) is 3,3-bis(ethylsulfanyl)-N,N-dimethylprop-2-en-1-amine.
What is the SMILES notation for 3,3-bis(ethylsulfanyl)-N,N-dimethylprop-2-en-1-amine?
The canonical SMILES for 3,3-bis(ethylsulfanyl)-N,N-dimethylprop-2-en-1-amine is CCSC(=CCN(C)C)SCC.
What is the InChIKey of 3,3-bis(ethylsulfanyl)-N,N-dimethylprop-2-en-1-amine?
The InChIKey is WWYAARCXIJEJPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NS2/c1-5-11-9(12-6-2)7-8-10(3)4/h7H,5-6,8H2,1-4H3.
What are the key properties of 3,3-bis(ethylsulfanyl)-N,N-dimethylprop-2-en-1-amine?
3,3-bis(ethylsulfanyl)-N,N-dimethylprop-2-en-1-amine has a molecular weight of 205.39 g/mol, XLogP of 2.90, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(ethylsulfanyl)-N,N-dimethylprop-2-en-1-amine is sourced from PubChem (CID 10965650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).