C12H16O3 — CID 10965716
(3E,10Z)-1-oxacyclotrideca-3,10-diene-2,7-dione (PubChem CID 10965716) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (3E,10Z)-1-oxacyclotrideca-3,10-diene-2,7-dione.
| Compound Name | (3E,10Z)-1-oxacyclotrideca-3,10-diene-2,7-dione |
|---|---|
| PubChem CID | 10965716 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3E,10Z)-1-oxacyclotrideca-3,10-diene-2,7-dione |
| SMILES | O=C1CC/C=C\CCOC(=O)/C=C/CC1 |
| InChI | InChI=1S/C12H16O3/c13-11-7-3-1-2-6-10-15-12(14)9-5-4-8-11/h1-2,5,9H,3-4,6-8,10H2/b2-1-,9-5+ |
| InChIKey | QPFMJNUWOHGONF-RLKBUKNLSA-N |
| XLogP | 2.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|