C15H16O — CID 10965837
11,14-dimethyl-4-oxatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaene (PubChem CID 10965837) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is 11,14-dimethyl-4-oxatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaene.
| Compound Name | 11,14-dimethyl-4-oxatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaene |
|---|---|
| PubChem CID | 10965837 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 11,14-dimethyl-4-oxatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaene |
| SMILES | Cc1ccc(C)c2c1CCc1ccoc1C2 |
| InChI | InChI=1S/C15H16O/c1-10-3-4-11(2)14-9-15-12(7-8-16-15)5-6-13(10)14/h3-4,7-8H,5-6,9H2,1-2H3 |
| InChIKey | JRTMWUAPYIQOCH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |