methyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate

C9H13NO5 — CID 10965896

IUPACmethyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate
SMILESCOC(=O)CN1C[C@H](OC(C)=O)CC1=O
InChIInChI=1S/C9H13NO5/c1-6(11)15-7-3-8(12)10(4-7)5-9(13)14-2/h7H,3-5H2,1-2H3/t7-/m1/s1
InChIKeySYKBLLJREOVYRL-SSDOTTSWSA-N
MW215.20 g/mol
LogP-0.68
Rot. Bonds3

About methyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate

methyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate (PubChem CID 10965896) has the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. Its IUPAC name is methyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate
PubChem CID10965896
Molecular FormulaC9H13NO5
Molecular Weight215.20 g/mol
Exact Mass215.08
IUPAC Namemethyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate
SMILESCOC(=O)CN1C[C@H](OC(C)=O)CC1=O
InChIInChI=1S/C9H13NO5/c1-6(11)15-7-3-8(12)10(4-7)5-9(13)14-2/h7H,3-5H2,1-2H3/t7-/m1/s1
InChIKeySYKBLLJREOVYRL-SSDOTTSWSA-N
XLogP-0.68
TPSA72.91 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.20
LogP ≤ 5-0.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate?
The IUPAC name of methyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate (CID 10965896) is methyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate.
What is the SMILES notation for methyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate?
The canonical SMILES for methyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate is COC(=O)CN1C[C@H](OC(C)=O)CC1=O.
What is the InChIKey of methyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate?
The InChIKey is SYKBLLJREOVYRL-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H13NO5/c1-6(11)15-7-3-8(12)10(4-7)5-9(13)14-2/h7H,3-5H2,1-2H3/t7-/m1/s1.
What are the key properties of methyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate?
methyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate has a molecular weight of 215.20 g/mol, XLogP of -0.68, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4R)-4-acetyloxy-2-oxopyrrolidin-1-yl]acetate is sourced from PubChem (CID 10965896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).