C13H14O3 — CID 10965989
ethyl (1S,2R,6R,7R)-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate (PubChem CID 10965989) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is ethyl (1S,2R,6R,7R)-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate.
| Compound Name | ethyl (1S,2R,6R,7R)-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate |
|---|---|
| PubChem CID | 10965989 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | ethyl (1S,2R,6R,7R)-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H]2[C@H](C1=O)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C13H14O3/c1-2-16-13(15)10-6-9-7-3-4-8(5-7)11(9)12(10)14/h3-4,6-9,11H,2,5H2,1H3/t7-,8+,9+,11-/m1/s1 |
| InChIKey | DKCQSQQNOATKKK-UYAYMFIHSA-N |
| XLogP | 1.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|