methyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate

C12H13NO3 — CID 10966017

IUPACmethyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate
SMILESCOC(=O)[C@@H]1Cc2ccccc2N1C(C)=O
InChIInChI=1S/C12H13NO3/c1-8(14)13-10-6-4-3-5-9(10)7-11(13)12(15)16-2/h3-6,11H,7H2,1-2H3/t11-/m0/s1
InChIKeyOLNXWFGVNGEHRF-NSHDSACASA-N
MW219.24 g/mol
LogP1.14
Rot. Bonds1

About methyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate

methyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate (PubChem CID 10966017) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is methyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate.

Molecular Properties

Compound Namemethyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate
PubChem CID10966017
Molecular FormulaC12H13NO3
Molecular Weight219.24 g/mol
Exact Mass219.09
IUPAC Namemethyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate
SMILESCOC(=O)[C@@H]1Cc2ccccc2N1C(C)=O
InChIInChI=1S/C12H13NO3/c1-8(14)13-10-6-4-3-5-9(10)7-11(13)12(15)16-2/h3-6,11H,7H2,1-2H3/t11-/m0/s1
InChIKeyOLNXWFGVNGEHRF-NSHDSACASA-N
XLogP1.14
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.24
LogP ≤ 51.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate?
The IUPAC name of methyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate (CID 10966017) is methyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate.
What is the SMILES notation for methyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate?
The canonical SMILES for methyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate is COC(=O)[C@@H]1Cc2ccccc2N1C(C)=O.
What is the InChIKey of methyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate?
The InChIKey is OLNXWFGVNGEHRF-NSHDSACASA-N. The full InChI is InChI=1S/C12H13NO3/c1-8(14)13-10-6-4-3-5-9(10)7-11(13)12(15)16-2/h3-6,11H,7H2,1-2H3/t11-/m0/s1.
What are the key properties of methyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate?
methyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate has a molecular weight of 219.24 g/mol, XLogP of 1.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-1-acetyl-2,3-dihydroindole-2-carboxylate is sourced from PubChem (CID 10966017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).