About 1-chloro-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylbutan-2-ol
1-chloro-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylbutan-2-ol (PubChem CID 10966030) has the molecular formula C10H18ClNO2
and a molecular weight of 219.71 g/mol. Its IUPAC name is 1-chloro-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylbutan-2-ol.
Molecular Properties
| Compound Name | 1-chloro-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylbutan-2-ol |
| PubChem CID | 10966030 |
| Molecular Formula | C10H18ClNO2 |
| Molecular Weight | 219.71 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1-chloro-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylbutan-2-ol |
| SMILES | CC(C)C(O)C(Cl)C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C10H18ClNO2/c1-6(2)8(13)7(11)9-12-10(3,4)5-14-9/h6-8,13H,5H2,1-4H3 |
| InChIKey | XKLQXBCRUXRWQS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.71 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylbutan-2-ol?
The IUPAC name of 1-chloro-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylbutan-2-ol (CID 10966030) is 1-chloro-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylbutan-2-ol.
What is the SMILES notation for 1-chloro-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylbutan-2-ol?
The canonical SMILES for 1-chloro-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylbutan-2-ol is CC(C)C(O)C(Cl)C1=NC(C)(C)CO1.
What is the InChIKey of 1-chloro-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylbutan-2-ol?
The InChIKey is XKLQXBCRUXRWQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18ClNO2/c1-6(2)8(13)7(11)9-12-10(3,4)5-14-9/h6-8,13H,5H2,1-4H3.
What are the key properties of 1-chloro-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylbutan-2-ol?
1-chloro-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylbutan-2-ol has a molecular weight of 219.71 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylbutan-2-ol is sourced from PubChem (CID 10966030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).