C14H20O2 — CID 10966046
7,7-dimethyl-3-(2-methylprop-1-enyl)-1,3,5,6-tetrahydro-2-benzofuran-4-one (PubChem CID 10966046) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 7,7-dimethyl-3-(2-methylprop-1-enyl)-1,3,5,6-tetrahydro-2-benzofuran-4-one.
| Compound Name | 7,7-dimethyl-3-(2-methylprop-1-enyl)-1,3,5,6-tetrahydro-2-benzofuran-4-one |
|---|---|
| PubChem CID | 10966046 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 7,7-dimethyl-3-(2-methylprop-1-enyl)-1,3,5,6-tetrahydro-2-benzofuran-4-one |
| SMILES | CC(C)=CC1OCC2=C1C(=O)CCC2(C)C |
| InChI | InChI=1S/C14H20O2/c1-9(2)7-12-13-10(8-16-12)14(3,4)6-5-11(13)15/h7,12H,5-6,8H2,1-4H3 |
| InChIKey | HWFKVLHYAXIVAM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|