About 1-butyl-7-methyl-3H-imidazo[1,2-a]pyrimidine-2,5-dione
1-butyl-7-methyl-3H-imidazo[1,2-a]pyrimidine-2,5-dione (PubChem CID 10966070) has the molecular formula C11H15N3O2
and a molecular weight of 221.26 g/mol. Its IUPAC name is 1-butyl-7-methyl-3H-imidazo[1,2-a]pyrimidine-2,5-dione.
Molecular Properties
| Compound Name | 1-butyl-7-methyl-3H-imidazo[1,2-a]pyrimidine-2,5-dione |
| PubChem CID | 10966070 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 1-butyl-7-methyl-3H-imidazo[1,2-a]pyrimidine-2,5-dione |
| SMILES | CCCCN1C(=O)Cn2c1nc(C)cc2=O |
| InChI | InChI=1S/C11H15N3O2/c1-3-4-5-13-10(16)7-14-9(15)6-8(2)12-11(13)14/h6H,3-5,7H2,1-2H3 |
| InChIKey | WKEHPKHQIAVKJO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butyl-7-methyl-3H-imidazo[1,2-a]pyrimidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-7-methyl-3H-imidazo[1,2-a]pyrimidine-2,5-dione?
The IUPAC name of 1-butyl-7-methyl-3H-imidazo[1,2-a]pyrimidine-2,5-dione (CID 10966070) is 1-butyl-7-methyl-3H-imidazo[1,2-a]pyrimidine-2,5-dione.
What is the SMILES notation for 1-butyl-7-methyl-3H-imidazo[1,2-a]pyrimidine-2,5-dione?
The canonical SMILES for 1-butyl-7-methyl-3H-imidazo[1,2-a]pyrimidine-2,5-dione is CCCCN1C(=O)Cn2c1nc(C)cc2=O.
What is the InChIKey of 1-butyl-7-methyl-3H-imidazo[1,2-a]pyrimidine-2,5-dione?
The InChIKey is WKEHPKHQIAVKJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O2/c1-3-4-5-13-10(16)7-14-9(15)6-8(2)12-11(13)14/h6H,3-5,7H2,1-2H3.
What are the key properties of 1-butyl-7-methyl-3H-imidazo[1,2-a]pyrimidine-2,5-dione?
1-butyl-7-methyl-3H-imidazo[1,2-a]pyrimidine-2,5-dione has a molecular weight of 221.26 g/mol, XLogP of 0.70, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-7-methyl-3H-imidazo[1,2-a]pyrimidine-2,5-dione is sourced from PubChem (CID 10966070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).