C10H7ClN2O2 — CID 10966112
9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-3-carbonyl chloride (PubChem CID 10966112) has the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. Its IUPAC name is 9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-3-carbonyl chloride.
| Compound Name | 9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-3-carbonyl chloride |
|---|---|
| PubChem CID | 10966112 |
| Molecular Formula | C10H7ClN2O2 |
| Molecular Weight | 222.63 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-3-carbonyl chloride |
| SMILES | O=C(Cl)c1nn2c3c(cccc13)OCC2 |
| InChI | InChI=1S/C10H7ClN2O2/c11-10(14)8-6-2-1-3-7-9(6)13(12-8)4-5-15-7/h1-3H,4-5H2 |
| InChIKey | KSIWODDDJZIMGH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.63 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|