C13H24O3 — CID 10966260
(1S,4S,6R)-1-[(E,3S)-3-hydroxybut-1-enyl]-2,2,6-trimethylcyclohexane-1,4-diol (PubChem CID 10966260) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (1S,4S,6R)-1-[(E,3S)-3-hydroxybut-1-enyl]-2,2,6-trimethylcyclohexane-1,4-diol.
| Compound Name | (1S,4S,6R)-1-[(E,3S)-3-hydroxybut-1-enyl]-2,2,6-trimethylcyclohexane-1,4-diol |
|---|---|
| PubChem CID | 10966260 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (1S,4S,6R)-1-[(E,3S)-3-hydroxybut-1-enyl]-2,2,6-trimethylcyclohexane-1,4-diol |
| SMILES | C[C@H](O)/C=C/[C@@]1(O)[C@H](C)C[C@H](O)CC1(C)C |
| InChI | InChI=1S/C13H24O3/c1-9-7-11(15)8-12(3,4)13(9,16)6-5-10(2)14/h5-6,9-11,14-16H,7-8H2,1-4H3/b6-5+/t9-,10+,11+,13-/m1/s1 |
| InChIKey | OJGKTHCXUFNMIQ-VZTUNGRISA-N |
| XLogP | 1.47 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|