About methyl 3-hydroxy-2,2-dimethyldecanoate
methyl 3-hydroxy-2,2-dimethyldecanoate (PubChem CID 10966321) has the molecular formula C13H26O3
and a molecular weight of 230.35 g/mol. Its IUPAC name is methyl 3-hydroxy-2,2-dimethyldecanoate.
Molecular Properties
| Compound Name | methyl 3-hydroxy-2,2-dimethyldecanoate |
| PubChem CID | 10966321 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | methyl 3-hydroxy-2,2-dimethyldecanoate |
| SMILES | CCCCCCCC(O)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C13H26O3/c1-5-6-7-8-9-10-11(14)13(2,3)12(15)16-4/h11,14H,5-10H2,1-4H3 |
| InChIKey | QNVUXKVMKHJCLI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-hydroxy-2,2-dimethyldecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-hydroxy-2,2-dimethyldecanoate?
The IUPAC name of methyl 3-hydroxy-2,2-dimethyldecanoate (CID 10966321) is methyl 3-hydroxy-2,2-dimethyldecanoate.
What is the SMILES notation for methyl 3-hydroxy-2,2-dimethyldecanoate?
The canonical SMILES for methyl 3-hydroxy-2,2-dimethyldecanoate is CCCCCCCC(O)C(C)(C)C(=O)OC.
What is the InChIKey of methyl 3-hydroxy-2,2-dimethyldecanoate?
The InChIKey is QNVUXKVMKHJCLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O3/c1-5-6-7-8-9-10-11(14)13(2,3)12(15)16-4/h11,14H,5-10H2,1-4H3.
What are the key properties of methyl 3-hydroxy-2,2-dimethyldecanoate?
methyl 3-hydroxy-2,2-dimethyldecanoate has a molecular weight of 230.35 g/mol, XLogP of 2.91, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-hydroxy-2,2-dimethyldecanoate is sourced from PubChem (CID 10966321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).