About (2E,4E)-1-diethoxyphosphoryl-4-methylhexa-2,4-diene
(2E,4E)-1-diethoxyphosphoryl-4-methylhexa-2,4-diene (PubChem CID 10966369) has the molecular formula C11H21O3P
and a molecular weight of 232.26 g/mol. Its IUPAC name is (2E,4E)-1-diethoxyphosphoryl-4-methylhexa-2,4-diene.
Molecular Properties
| Compound Name | (2E,4E)-1-diethoxyphosphoryl-4-methylhexa-2,4-diene |
| PubChem CID | 10966369 |
| Molecular Formula | C11H21O3P |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (2E,4E)-1-diethoxyphosphoryl-4-methylhexa-2,4-diene |
| SMILES | C/C=C(C)/C=C/CP(=O)(OCC)OCC |
| InChI | InChI=1S/C11H21O3P/c1-5-11(4)9-8-10-15(12,13-6-2)14-7-3/h5,8-9H,6-7,10H2,1-4H3/b9-8+,11-5+ |
| InChIKey | DELDOTLENOAILT-SXGHKVHISA-N |
| XLogP | 3.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-1-diethoxyphosphoryl-4-methylhexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-1-diethoxyphosphoryl-4-methylhexa-2,4-diene?
The IUPAC name of (2E,4E)-1-diethoxyphosphoryl-4-methylhexa-2,4-diene (CID 10966369) is (2E,4E)-1-diethoxyphosphoryl-4-methylhexa-2,4-diene.
What is the SMILES notation for (2E,4E)-1-diethoxyphosphoryl-4-methylhexa-2,4-diene?
The canonical SMILES for (2E,4E)-1-diethoxyphosphoryl-4-methylhexa-2,4-diene is C/C=C(C)/C=C/CP(=O)(OCC)OCC.
What is the InChIKey of (2E,4E)-1-diethoxyphosphoryl-4-methylhexa-2,4-diene?
The InChIKey is DELDOTLENOAILT-SXGHKVHISA-N. The full InChI is InChI=1S/C11H21O3P/c1-5-11(4)9-8-10-15(12,13-6-2)14-7-3/h5,8-9H,6-7,10H2,1-4H3/b9-8+,11-5+.
What are the key properties of (2E,4E)-1-diethoxyphosphoryl-4-methylhexa-2,4-diene?
(2E,4E)-1-diethoxyphosphoryl-4-methylhexa-2,4-diene has a molecular weight of 232.26 g/mol, XLogP of 3.77, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-1-diethoxyphosphoryl-4-methylhexa-2,4-diene is sourced from PubChem (CID 10966369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).