C12H11NO4 — CID 10966399
6-hydroxy-4-methoxy-6-phenyl-1H-pyridine-2,5-dione (PubChem CID 10966399) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 6-hydroxy-4-methoxy-6-phenyl-1H-pyridine-2,5-dione.
| Compound Name | 6-hydroxy-4-methoxy-6-phenyl-1H-pyridine-2,5-dione |
|---|---|
| PubChem CID | 10966399 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 6-hydroxy-4-methoxy-6-phenyl-1H-pyridine-2,5-dione |
| SMILES | COC1=CC(=O)NC(O)(c2ccccc2)C1=O |
| InChI | InChI=1S/C12H11NO4/c1-17-9-7-10(14)13-12(16,11(9)15)8-5-3-2-4-6-8/h2-7,16H,1H3,(H,13,14) |
| InChIKey | MKGAFCAZWHIASI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |