About pent-4-ynyl 4-methylbenzenesulfonate
pent-4-ynyl 4-methylbenzenesulfonate (PubChem CID 10966564) has the molecular formula C12H14O3S
and a molecular weight of 238.31 g/mol. Its IUPAC name is pent-4-ynyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | pent-4-ynyl 4-methylbenzenesulfonate |
| PubChem CID | 10966564 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | pent-4-ynyl 4-methylbenzenesulfonate |
| SMILES | C#CCCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H14O3S/c1-3-4-5-10-15-16(13,14)12-8-6-11(2)7-9-12/h1,6-9H,4-5,10H2,2H3 |
| InChIKey | HUDMRXOBWIYVMZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze pent-4-ynyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-4-ynyl 4-methylbenzenesulfonate?
The IUPAC name of pent-4-ynyl 4-methylbenzenesulfonate (CID 10966564) is pent-4-ynyl 4-methylbenzenesulfonate.
What is the SMILES notation for pent-4-ynyl 4-methylbenzenesulfonate?
The canonical SMILES for pent-4-ynyl 4-methylbenzenesulfonate is C#CCCCOS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of pent-4-ynyl 4-methylbenzenesulfonate?
The InChIKey is HUDMRXOBWIYVMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3S/c1-3-4-5-10-15-16(13,14)12-8-6-11(2)7-9-12/h1,6-9H,4-5,10H2,2H3.
What are the key properties of pent-4-ynyl 4-methylbenzenesulfonate?
pent-4-ynyl 4-methylbenzenesulfonate has a molecular weight of 238.31 g/mol, XLogP of 2.11, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pent-4-ynyl 4-methylbenzenesulfonate is sourced from PubChem (CID 10966564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).